Difference between revisions of "CPD-15280"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10664 == * transcription-direction: ** negative * right-end-position: ** 214803 * left-end-position: ** 203904 * centisome-position: ** 25.872793...")
(Created page with "Category:metabolite == Metabolite CPD-12173 == * common-name: ** (s)-3-hydroxy-isobutanoyl-coa * smiles: ** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ10664 ==
+
== Metabolite CPD-12173 ==
* transcription-direction:
+
* common-name:
** negative
+
** (s)-3-hydroxy-isobutanoyl-coa
* right-end-position:
+
* smiles:
** 214803
+
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])co
* left-end-position:
+
* inchi-key:
** 203904
+
** wweogfzefhpuam-uqcjfraesa-j
* centisome-position:
+
* molecular-weight:
** 25.872793   
+
** 849.593
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN]]
== Reaction(s) associated ==
+
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
* [[RXN-15559]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
* [[RXN-15560]]
+
{{#set: common-name=(s)-3-hydroxy-isobutanoyl-coa}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=wweogfzefhpuam-uqcjfraesa-j}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=849.593}}
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-7511]]
 
** '''7''' reactions found over '''9''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=214803}}
 
{{#set: left-end-position=203904}}
 
{{#set: centisome-position=25.872793    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=3}}
 
{{#set: nb pathway associated=1}}
 

Revision as of 20:31, 18 December 2020

Metabolite CPD-12173

  • common-name:
    • (s)-3-hydroxy-isobutanoyl-coa
  • smiles:
    • cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])co
  • inchi-key:
    • wweogfzefhpuam-uqcjfraesa-j
  • molecular-weight:
    • 849.593

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality