Difference between revisions of "CPD-15301"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ18796 == * transcription-direction: ** negative * right-end-position: ** 76008 * left-end-position: ** 73456 * centisome-position: ** 31.1216 =...")
 
(Created page with "Category:metabolite == Metabolite CPD-15301 == * common-name: ** caldariellaquinol * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(c(sc)=c(o)c1(=c(sc=c1)c(o)=2))...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ18796 ==
+
== Metabolite CPD-15301 ==
* transcription-direction:
+
* common-name:
** negative
+
** caldariellaquinol
* right-end-position:
+
* smiles:
** 76008
+
** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(c(sc)=c(o)c1(=c(sc=c1)c(o)=2))
* left-end-position:
+
* inchi-key:
** 73456
+
** uvcqokdzgiahdg-uhfffaoysa-n
* centisome-position:
+
* molecular-weight:
** 31.1216   
+
** 633.085
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-15378]]
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=caldariellaquinol}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=uvcqokdzgiahdg-uhfffaoysa-n}}
{{#set: transcription-direction=negative}}
+
{{#set: molecular-weight=633.085}}
{{#set: right-end-position=76008}}
 
{{#set: left-end-position=73456}}
 
{{#set: centisome-position=31.1216    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-15301

  • common-name:
    • caldariellaquinol
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(c(sc)=c(o)c1(=c(sc=c1)c(o)=2))
  • inchi-key:
    • uvcqokdzgiahdg-uhfffaoysa-n
  • molecular-weight:
    • 633.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality