Difference between revisions of "CPD-15301"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18796 == * transcription-direction: ** negative * right-end-position: ** 76008 * left-end-position: ** 73456 * centisome-position: ** 31.1216 =...") |
(Created page with "Category:metabolite == Metabolite CPD-15301 == * common-name: ** caldariellaquinol * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(c(sc)=c(o)c1(=c(sc=c1)c(o)=2))...") |
||
(9 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-15301 == |
− | * | + | * common-name: |
− | ** | + | ** caldariellaquinol |
− | * | + | * smiles: |
− | ** | + | ** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(c(sc)=c(o)c1(=c(sc=c1)c(o)=2)) |
− | * | + | * inchi-key: |
− | ** | + | ** uvcqokdzgiahdg-uhfffaoysa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 633.085 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[RXN-15378]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=caldariellaquinol}} | |
− | + | {{#set: inchi-key=inchikey=uvcqokdzgiahdg-uhfffaoysa-n}} | |
− | {{#set: | + | {{#set: molecular-weight=633.085}} |
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-15301
- common-name:
- caldariellaquinol
- smiles:
- cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(c(sc)=c(o)c1(=c(sc=c1)c(o)=2))
- inchi-key:
- uvcqokdzgiahdg-uhfffaoysa-n
- molecular-weight:
- 633.085