Difference between revisions of "CPD-15301"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ == * common-name: ** 6-methoxy-3-methyl-2-all-trans-hexaprenyl-1,4-benzoquinol * smiles: ** cc(c)...")
(Created page with "Category:metabolite == Metabolite Deoxy-Ribonucleoside-Triphosphates == * common-name: ** a 2'-deoxyribonucleoside 5'-triphosphate == Reaction(s) known to consume the comp...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ ==
+
== Metabolite Deoxy-Ribonucleoside-Triphosphates ==
 
* common-name:
 
* common-name:
** 6-methoxy-3-methyl-2-all-trans-hexaprenyl-1,4-benzoquinol
+
** a 2'-deoxyribonucleoside 5'-triphosphate
* smiles:
 
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c
 
* inchi-key:
 
** atqqulxelmejix-nsuijkaqsa-n
 
* molecular-weight:
 
** 562.874
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
 +
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN3O-54]]
+
* [[1.17.4.2-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-hexaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=a 2'-deoxyribonucleoside 5'-triphosphate}}
{{#set: inchi-key=inchikey=atqqulxelmejix-nsuijkaqsa-n}}
 
{{#set: molecular-weight=562.874}}
 

Revision as of 14:56, 5 January 2021

Metabolite Deoxy-Ribonucleoside-Triphosphates

  • common-name:
    • a 2'-deoxyribonucleoside 5'-triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality