Difference between revisions of "CPD-15318"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ11677 == * transcription-direction: ** positive * right-end-position: ** 209773 * left-end-position: ** 201052 * centisome-position: ** 54.351746...") |
(Created page with "Category:metabolite == Metabolite CPD-15318 == * common-name: ** α-d-ribose 5-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) * inchi-key: ** ktvpxoyakd...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-15318 == |
− | * | + | * common-name: |
− | ** | + | ** α-d-ribose 5-phosphate |
− | * | + | * smiles: |
− | ** | + | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) |
− | * | + | * inchi-key: |
− | ** | + | ** ktvpxoyakdprhy-aihaylrmsa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 228.095 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[R5PDP]] |
− | + | * [[RPDPK]] | |
− | * [[ | + | * [[RXN-14456]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[ARDP]] |
− | * [[ | + | * [[RIBOKIN-RXN]] |
− | * | + | * [[RPDPK]] |
− | * | + | * [[RXN-14456]] |
− | + | * [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]] | |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=α-d-ribose 5-phosphate}} | |
− | {{#set: | + | {{#set: inchi-key=inchikey=ktvpxoyakdprhy-aihaylrmsa-l}} |
− | {{#set: | + | {{#set: molecular-weight=228.095}} |
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-15318
- common-name:
- α-d-ribose 5-phosphate
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1)
- inchi-key:
- ktvpxoyakdprhy-aihaylrmsa-l
- molecular-weight:
- 228.095