Difference between revisions of "CPD-15360"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8080 == * common-name: ** 1-18:2-2-16:3-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc...") |
(Created page with "Category:metabolite == Metabolite 3-P-HYDROXYPYRUVATE == * common-name: ** 3-phosphooxypyruvate * smiles: ** c(op([o-])(=o)[o-])c(=o)c(=o)[o-] * inchi-key: ** lflucdosqpjj...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-P-HYDROXYPYRUVATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-phosphooxypyruvate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(op([o-])(=o)[o-])c(=o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lflucdosqpjjbe-uhfffaoysa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 181.018 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[PGLYCDEHYDROG-RXN]] |
| + | * [[PSERTRANSAM-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[PGLYCDEHYDROG-RXN]] |
| + | * [[PSERTRANSAM-RXN]] | ||
| + | * [[RXN-17808]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-phosphooxypyruvate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lflucdosqpjjbe-uhfffaoysa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=181.018}} |
Revision as of 11:15, 15 January 2021
Contents
Metabolite 3-P-HYDROXYPYRUVATE
- common-name:
- 3-phosphooxypyruvate
- smiles:
- c(op([o-])(=o)[o-])c(=o)c(=o)[o-]
- inchi-key:
- lflucdosqpjjbe-uhfffaoysa-k
- molecular-weight:
- 181.018
