Difference between revisions of "CPD-15360"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-P-HYDROXYPYRUVATE == * common-name: ** 3-phosphooxypyruvate * smiles: ** c(op([o-])(=o)[o-])c(=o)c(=o)[o-] * inchi-key: ** lflucdosqpjj...") |
(Created page with "Category:metabolite == Metabolite CPD-15360 == * smiles: ** cc(c)=ccnc3(c2(n=cn(c1(oc(cop(=o)([o-])o[a trna])c(op([o-])(=o)o[a trna])c(o)1))c=2n=c(s)n=3)) * common-name: *...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15360 == |
| + | * smiles: | ||
| + | ** cc(c)=ccnc3(c2(n=cn(c1(oc(cop(=o)([o-])o[a trna])c(op([o-])(=o)o[a trna])c(o)1))c=2n=c(s)n=3)) | ||
* common-name: | * common-name: | ||
| − | ** | + | ** 2-sulfanyl-n6-dimethylallyladenosine37 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14481]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-14480]] | |
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-sulfanyl-n6-dimethylallyladenosine37 in trna}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-15360
- smiles:
- cc(c)=ccnc3(c2(n=cn(c1(oc(cop(=o)([o-])o[a trna])c(op([o-])(=o)o[a trna])c(o)1))c=2n=c(s)n=3))
- common-name:
- 2-sulfanyl-n6-dimethylallyladenosine37 in trna
