Difference between revisions of "CPD-15360"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP-4-AMINO-4-DEOXY-L-ARABINOSE == * common-name: ** udp-4-amino-4-deoxy-β-l-arabinopyranose * smiles: ** c(op(=o)([o-])op(=o)([o-])...")
(Created page with "Category:metabolite == Metabolite CPD0-2121 == * common-name: ** trans-hex-2-enoyl-coa * smiles: ** cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UDP-4-AMINO-4-DEOXY-L-ARABINOSE ==
+
== Metabolite CPD0-2121 ==
 
* common-name:
 
* common-name:
** udp-4-amino-4-deoxy-β-l-arabinopyranose
+
** trans-hex-2-enoyl-coa
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)([o-])oc1(occ([n+])c(o)c(o)1))c2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3))
+
** cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** gwbakybswhqnmq-iazovdbxsa-m
+
** oinxhibnzuuimr-ixuyqxaasa-j
 
* molecular-weight:
 
* molecular-weight:
** 534.286
+
** 859.631
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-1863]]
+
* [[ECOAH2h]]
 +
* [[RXN-12559]]
 +
* [[RXN-14278]]
 +
* [[TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-1863]]
+
* [[ECOAH2h]]
 +
* [[RXN-12567]]
 +
* [[RXN-14278]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-4-amino-4-deoxy-β-l-arabinopyranose}}
+
{{#set: common-name=trans-hex-2-enoyl-coa}}
{{#set: inchi-key=inchikey=gwbakybswhqnmq-iazovdbxsa-m}}
+
{{#set: inchi-key=inchikey=oinxhibnzuuimr-ixuyqxaasa-j}}
{{#set: molecular-weight=534.286}}
+
{{#set: molecular-weight=859.631}}

Revision as of 13:09, 14 January 2021

Metabolite CPD0-2121

  • common-name:
    • trans-hex-2-enoyl-coa
  • smiles:
    • cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • oinxhibnzuuimr-ixuyqxaasa-j
  • molecular-weight:
    • 859.631

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality