Difference between revisions of "CPD-15361"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20077 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * NARINGENIN-CHALCONE-SYNT...") |
(Created page with "Category:metabolite == Metabolite CPD-15361 == * common-name: ** 3r-hydroxy-(11z)-eicos-11-enoyl-coa * smiles: ** ccccccccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)c...") |
||
(7 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-15361 == |
− | + | * common-name: | |
− | * | + | ** 3r-hydroxy-(11z)-eicos-11-enoyl-coa |
− | + | * smiles: | |
− | + | ** ccccccccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | |
− | * | + | * inchi-key: |
− | ** | + | ** preomqknjxwclz-zhlmiuqrsa-j |
− | + | * molecular-weight: | |
− | * | + | ** 1072.006 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-14485]] |
− | ** | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[RXN-14484]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=3r-hydroxy-(11z)-eicos-11-enoyl-coa}} | |
− | * [[ | + | {{#set: inchi-key=inchikey=preomqknjxwclz-zhlmiuqrsa-j}} |
− | + | {{#set: molecular-weight=1072.006}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | {{#set: |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-15361
- common-name:
- 3r-hydroxy-(11z)-eicos-11-enoyl-coa
- smiles:
- ccccccccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- preomqknjxwclz-zhlmiuqrsa-j
- molecular-weight:
- 1072.006