Difference between revisions of "CPD-15361"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ20077 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * NARINGENIN-CHALCONE-SYNT...")
(Created page with "Category:metabolite == Metabolite CPD-15361 == * common-name: ** 3r-hydroxy-(11z)-eicos-11-enoyl-coa * smiles: ** ccccccccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)c...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ20077 ==
+
== Metabolite CPD-15361 ==
−
== Organism(s) associated with this gene  ==
+
* common-name:
−
* [[S.japonica_carotenoid_curated]]
+
** 3r-hydroxy-(11z)-eicos-11-enoyl-coa
−
== Reaction(s) associated ==
+
* smiles:
−
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
+
** ccccccccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
** Category: [[orthology]]
+
* inchi-key:
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
** preomqknjxwclz-zhlmiuqrsa-j
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* molecular-weight:
−
* [[RXN-7645]]
+
** 1072.006
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-14485]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) associated ==
+
* [[RXN-14484]]
−
* [[PWY-6787]]
+
== Reaction(s) of unknown directionality ==
−
** '''6''' reactions found over '''10''' reactions in the full pathway
+
{{#set: common-name=3r-hydroxy-(11z)-eicos-11-enoyl-coa}}
−
* [[PWY1F-FLAVSYN]]
+
{{#set: inchi-key=inchikey=preomqknjxwclz-zhlmiuqrsa-j}}
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
{{#set: molecular-weight=1072.006}}
−
* [[PWY-5135]]
 
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-7397]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6316]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-7897]]
 
−
** '''3''' reactions found over '''15''' reactions in the full pathway
 
−
* [[PWY-5059]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=7}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-15361

  • common-name:
    • 3r-hydroxy-(11z)-eicos-11-enoyl-coa
  • smiles:
    • ccccccccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • preomqknjxwclz-zhlmiuqrsa-j
  • molecular-weight:
    • 1072.006

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-15361&oldid=137166"