Difference between revisions of "CPD-15362"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-DEHYDRATASE-RXN GLYCEROL-DEHYDRATASE-RXN] == * direction: ** left-to-right * ec-number: **...")
(Created page with "Category:metabolite == Metabolite CPD-15362 == * common-name: ** (2e,11z)-icosa-2,11-dienoyl-coa * smiles: ** ccccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-DEHYDRATASE-RXN GLYCEROL-DEHYDRATASE-RXN] ==
+
== Metabolite CPD-15362 ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** (2e,11z)-icosa-2,11-dienoyl-coa
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.2.1.30 ec-4.2.1.30]
+
** ccccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[GLYCEROL]][c] '''=>''' 1 [[HYDROXYPROPANAL]][c] '''+''' 1 [[WATER]][c]
+
** laeceuxzoonxdy-nwgwhigpsa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ15896]]
+
** 1053.99
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[RXN-14485]]
−
* [[PWY-7385]], 1,3-propanediol biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7385 PWY-7385]
+
== Reaction(s) of unknown directionality ==
−
** '''7''' reactions found over '''9''' reactions in the full pathway
+
{{#set: common-name=(2e,11z)-icosa-2,11-dienoyl-coa}}
−
* [[PWY-6130]], glycerol degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6130 PWY-6130]
+
{{#set: inchi-key=inchikey=laeceuxzoonxdy-nwgwhigpsa-j}}
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
{{#set: molecular-weight=1053.99}}
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19766 19766]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R01047 R01047]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-4.2.1.30}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-15362

  • common-name:
    • (2e,11z)-icosa-2,11-dienoyl-coa
  • smiles:
    • ccccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • laeceuxzoonxdy-nwgwhigpsa-j
  • molecular-weight:
    • 1053.99

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-15362&oldid=139717"