Difference between revisions of "CPD-15362"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ARDP ARDP] == * direction: ** left-to-right * common-name: ** adp-ribose diphosphatase == Reaction...")
(Created page with "Category:metabolite == Metabolite CPD-15362 == * common-name: ** (2e,11z)-icosa-2,11-dienoyl-coa * smiles: ** ccccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ARDP ARDP] ==
+
== Metabolite CPD-15362 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** adp-ribose diphosphatase
+
** (2e,11z)-icosa-2,11-dienoyl-coa
== Reaction formula ==
+
* smiles:
* 1.0 [[ADENOSINE_DIPHOSPHATE_RIBOSE]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[AMP]][c] '''+''' 1.0 [[CPD-15318]][c] '''+''' 2.0 [[PROTON]][c]
+
** ccccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Gene(s) associated with this reaction  ==
+
* inchi-key:
* Gene: [[SJ13701]]
+
** laeceuxzoonxdy-nwgwhigpsa-j
** Category: [[orthology]]
+
* molecular-weight:
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 1053.99
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
== Reconstruction information  ==
+
== Reaction(s) known to produce the compound ==
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-14485]]
== External links  ==
+
== Reaction(s) of unknown directionality ==
{{#set: direction=left-to-right}}
+
{{#set: common-name=(2e,11z)-icosa-2,11-dienoyl-coa}}
{{#set: common-name=adp-ribose diphosphatase}}
+
{{#set: inchi-key=inchikey=laeceuxzoonxdy-nwgwhigpsa-j}}
{{#set: nb gene associated=1}}
+
{{#set: molecular-weight=1053.99}}
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-15362

  • common-name:
    • (2e,11z)-icosa-2,11-dienoyl-coa
  • smiles:
    • ccccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • laeceuxzoonxdy-nwgwhigpsa-j
  • molecular-weight:
    • 1053.99

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality