Difference between revisions of "CPD-15365"

Revision as of 11:18, 15 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-15152 ==
+== Metabolite PALMITATE ==
 * common-name:
-** 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone
+** palmitate
 * smiles:
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c=1)
+** cccccccccccccccc([o-])=o
 * inchi-key:
-** aftbilpwmusgin-mycgwmctsa-n
+** ipcsvzssvzvige-uhfffaoysa-m
 * molecular-weight:
-** 683.068
+** 255.42
 == Reaction(s) known to consume the compound ==
-* [[RXN-14177]]
+* [[FATTY-ACID-PEROXIDASE-RXN]]
+* [[RXN-9623]]
 == Reaction(s) known to produce the compound ==
+* [[3.1.1.64-RXN]]
+* [[3.1.2.22-RXN]]
+* [[PALMITOYL-COA-HYDROLASE-RXN]]
+* [[RETINYL-PALMITATE-ESTERASE-RXN]]
+* [[RXN-12430]]
+* [[RXN-15065]]
+* [[RXN-16655]]
+* [[RXN-7952-CPD66-43/WATER//GLYCEROL/PALMITATE/PROTON.42.]]
+* [[RXN-9549]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone}}
+{{#set: common-name=palmitate}}
-{{#set: inchi-key=inchikey=aftbilpwmusgin-mycgwmctsa-n}}
+{{#set: inchi-key=inchikey=ipcsvzssvzvige-uhfffaoysa-m}}
-{{#set: molecular-weight=683.068}}
+{{#set: molecular-weight=255.42}}