Difference between revisions of "CPD-15365"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PALMITATE == * common-name: ** palmitate * smiles: ** cccccccccccccccc([o-])=o * inchi-key: ** ipcsvzssvzvige-uhfffaoysa-m * molecular-we...")
(Created page with "Category:metabolite == Metabolite CPD-15365 == * common-name: ** densipoloyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PALMITATE ==
+
== Metabolite CPD-15365 ==
 
* common-name:
 
* common-name:
** palmitate
+
** densipoloyl-coa
 
* smiles:
 
* smiles:
** cccccccccccccccc([o-])=o
+
** ccc=cccc(o)cc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** ipcsvzssvzvige-uhfffaoysa-m
+
** qebzgoipmjeisg-apevuuacsa-j
 
* molecular-weight:
 
* molecular-weight:
** 255.42
+
** 1041.936
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FATTY-ACID-PEROXIDASE-RXN]]
+
* [[RXN-16150]]
* [[RXN-9623]]
+
* [[RXN-16153]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.1.64-RXN]]
+
* [[RXN-16150]]
* [[3.1.2.22-RXN]]
 
* [[PALMITOYL-COA-HYDROLASE-RXN]]
 
* [[RETINYL-PALMITATE-ESTERASE-RXN]]
 
* [[RXN-12430]]
 
* [[RXN-15065]]
 
* [[RXN-16655]]
 
* [[RXN-7952-CPD66-43/WATER//GLYCEROL/PALMITATE/PROTON.42.]]
 
* [[RXN-9549]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=palmitate}}
+
{{#set: common-name=densipoloyl-coa}}
{{#set: inchi-key=inchikey=ipcsvzssvzvige-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=qebzgoipmjeisg-apevuuacsa-j}}
{{#set: molecular-weight=255.42}}
+
{{#set: molecular-weight=1041.936}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-15365

  • common-name:
    • densipoloyl-coa
  • smiles:
    • ccc=cccc(o)cc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • qebzgoipmjeisg-apevuuacsa-j
  • molecular-weight:
    • 1041.936

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality