Difference between revisions of "CPD-15365"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7659 RXN-7659] == * direction: ** reversible * common-name: ** dihydrogeranylgeranyl diphosphat...")
(Created page with "Category:metabolite == Metabolite CPD-15365 == * common-name: ** densipoloyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7659 RXN-7659] ==
+
== Metabolite CPD-15365 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** dihydrogeranylgeranyl diphosphate reductase
+
** densipoloyl-coa
−
== Reaction formula ==
+
* smiles:
−
* 1 [[CPD-7003]][c] '''+''' 1 [[NADP]][c] '''<=>''' 1 [[CPD-7002]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c]
+
** ccc=cccc(o)cc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ15264]]
+
** qebzgoipmjeisg-apevuuacsa-j
−
** Category: [[annotation]]
+
* molecular-weight:
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
** 1041.936
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-16150]]
−
== Pathway(s) ==
+
* [[RXN-16153]]
−
* [[PWY-5063]], phytyl diphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5063 PWY-5063]
+
== Reaction(s) known to produce the compound ==
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
* [[RXN-16150]]
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=densipoloyl-coa}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=qebzgoipmjeisg-apevuuacsa-j}}
−
== External links  ==
+
{{#set: molecular-weight=1041.936}}
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R08755 R08755]
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=dihydrogeranylgeranyl diphosphate reductase}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-15365

  • common-name:
    • densipoloyl-coa
  • smiles:
    • ccc=cccc(o)cc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • qebzgoipmjeisg-apevuuacsa-j
  • molecular-weight:
    • 1041.936

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-15365&oldid=138955"