Difference between revisions of "CPD-15365"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13390 == * common-name: ** l-methionyl-l-alanine dipeptide * smiles: ** cc(c(=o)[o-])nc(=o)c(ccsc)[n+] * inchi-key: ** jhkxzylnvjraaj...")
(Created page with "Category:metabolite == Metabolite CPD-15365 == * common-name: ** densipoloyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13390 ==
+
== Metabolite CPD-15365 ==
 
* common-name:
 
* common-name:
** l-methionyl-l-alanine dipeptide
+
** densipoloyl-coa
 
* smiles:
 
* smiles:
** cc(c(=o)[o-])nc(=o)c(ccsc)[n+]
+
** ccc=cccc(o)cc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** jhkxzylnvjraaj-wdskdsinsa-n
+
** qebzgoipmjeisg-apevuuacsa-j
 
* molecular-weight:
 
* molecular-weight:
** 220.286
+
** 1041.936
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6985]]
+
* [[RXN-16150]]
 +
* [[RXN-16153]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16150]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-methionyl-l-alanine dipeptide}}
+
{{#set: common-name=densipoloyl-coa}}
{{#set: inchi-key=inchikey=jhkxzylnvjraaj-wdskdsinsa-n}}
+
{{#set: inchi-key=inchikey=qebzgoipmjeisg-apevuuacsa-j}}
{{#set: molecular-weight=220.286}}
+
{{#set: molecular-weight=1041.936}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-15365

  • common-name:
    • densipoloyl-coa
  • smiles:
    • ccc=cccc(o)cc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • qebzgoipmjeisg-apevuuacsa-j
  • molecular-weight:
    • 1041.936

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality