Difference between revisions of "CPD-15368"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9451 == * common-name: ** 2-isopropylmaleate * smiles: ** cc(c(c(=o)[o-])=cc(=o)[o-])c * inchi-key: ** njmgrjlqrlfqqx-hyxafxhysa-l *...") |
(Created page with "Category:metabolite == Metabolite CPD-4184 == * common-name: ** 4α-methyl-cholesta-8-enol * smiles: ** cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)c(c)c(o)cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-4184 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4α-methyl-cholesta-8-enol |
* smiles: | * smiles: | ||
| − | ** cc(c(c(= | + | ** cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)c(c)c(o)cc3)))cc4)))c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** scezihjvtbqols-yijygbtnsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 400.687 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-19]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4α-methyl-cholesta-8-enol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=scezihjvtbqols-yijygbtnsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=400.687}} |
Revision as of 11:15, 15 January 2021
Contents
Metabolite CPD-4184
- common-name:
- 4α-methyl-cholesta-8-enol
- smiles:
- cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)c(c)c(o)cc3)))cc4)))c
- inchi-key:
- scezihjvtbqols-yijygbtnsa-n
- molecular-weight:
- 400.687
