Difference between revisions of "CPD-15370"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17396 == * common-name: ** a [glycerolipid]-ricinoleate == Reaction(s) known to consume the compound == * RXN-16149 * RXN-16151...")
(Created page with "Category:metabolite == Metabolite CPD-15370 == * common-name: ** trans-lesqueroloyl-coa * smiles: ** ccccccc(o)cc=ccccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17396 ==
+
== Metabolite CPD-15370 ==
 
* common-name:
 
* common-name:
** a [glycerolipid]-ricinoleate
+
** trans-lesqueroloyl-coa
 +
* smiles:
 +
** ccccccc(o)cc=ccccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 +
* inchi-key:
 +
** fgrjeqcmqcquqf-fscwmumrsa-j
 +
* molecular-weight:
 +
** 1069.99
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16149]]
 
* [[RXN-16151]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16151]]
+
* [[RXN-14494]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [glycerolipid]-ricinoleate}}
+
{{#set: common-name=trans-lesqueroloyl-coa}}
 +
{{#set: inchi-key=inchikey=fgrjeqcmqcquqf-fscwmumrsa-j}}
 +
{{#set: molecular-weight=1069.99}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-15370

  • common-name:
    • trans-lesqueroloyl-coa
  • smiles:
    • ccccccc(o)cc=ccccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • fgrjeqcmqcquqf-fscwmumrsa-j
  • molecular-weight:
    • 1069.99

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality