Difference between revisions of "CPD-15370"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8052 == * common-name: ** 1d-chiro-inositol * smiles: ** c1(c(c(c(c(c1o)o)o)o)o)o * inchi-key: ** cdaismweouebre-lkpkboigsa-n * molec...")
(Created page with "Category:metabolite == Metabolite SN-GLYCEROL-1-PHOSPHATE == * common-name: ** sn-glycerol 1-phosphate * smiles: ** c(op([o-])(=o)[o-])c(o)co * inchi-key: ** awucvroldviaj...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8052 ==
+
== Metabolite SN-GLYCEROL-1-PHOSPHATE ==
 
* common-name:
 
* common-name:
** 1d-chiro-inositol
+
** sn-glycerol 1-phosphate
 
* smiles:
 
* smiles:
** c1(c(c(c(c(c1o)o)o)o)o)o
+
** c(op([o-])(=o)[o-])c(o)co
 
* inchi-key:
 
* inchi-key:
** cdaismweouebre-lkpkboigsa-n
+
** awucvroldviajx-vkhmyheasa-l
 
* molecular-weight:
 
* molecular-weight:
** 180.157
+
** 170.058
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14148]]
+
* [[2.5.1.41-RXN]]
 +
* [[RXN-14964]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14148]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-chiro-inositol}}
+
{{#set: common-name=sn-glycerol 1-phosphate}}
{{#set: inchi-key=inchikey=cdaismweouebre-lkpkboigsa-n}}
+
{{#set: inchi-key=inchikey=awucvroldviajx-vkhmyheasa-l}}
{{#set: molecular-weight=180.157}}
+
{{#set: molecular-weight=170.058}}

Revision as of 13:10, 14 January 2021

Metabolite SN-GLYCEROL-1-PHOSPHATE

  • common-name:
    • sn-glycerol 1-phosphate
  • smiles:
    • c(op([o-])(=o)[o-])c(o)co
  • inchi-key:
    • awucvroldviajx-vkhmyheasa-l
  • molecular-weight:
    • 170.058

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality