Difference between revisions of "CPD-15424"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12121 == * common-name: ** demethylmenaquinol-12 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=c...")
(Created page with "Category:metabolite == Metabolite CPD-173 == * common-name: ** salicyl alcohol * smiles: ** c(c1(c=cc=cc=1o))o * inchi-key: ** cqryarsyncazfo-uhfffaoysa-n * molecular-weig...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12121 ==
+
== Metabolite CPD-173 ==
 
* common-name:
 
* common-name:
** demethylmenaquinol-12
+
** salicyl alcohol
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c
+
** c(c1(c=cc=cc=1o))o
 
* inchi-key:
 
* inchi-key:
** nkcmhmxwladgov-rvhibigxsa-n
+
** cqryarsyncazfo-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 977.59
+
** 124.139
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9363]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12252]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=demethylmenaquinol-12}}
+
{{#set: common-name=salicyl alcohol}}
{{#set: inchi-key=inchikey=nkcmhmxwladgov-rvhibigxsa-n}}
+
{{#set: inchi-key=inchikey=cqryarsyncazfo-uhfffaoysa-n}}
{{#set: molecular-weight=977.59}}
+
{{#set: molecular-weight=124.139}}

Revision as of 11:18, 15 January 2021

Metabolite CPD-173

  • common-name:
    • salicyl alcohol
  • smiles:
    • c(c1(c=cc=cc=1o))o
  • inchi-key:
    • cqryarsyncazfo-uhfffaoysa-n
  • molecular-weight:
    • 124.139

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality