Difference between revisions of "CPD-15424"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12121 == * common-name: ** demethylmenaquinol-12 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=c...")
(Created page with "Category:metabolite == Metabolite CPD-15424 == * common-name: ** o-carbamoyladenylate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o * inch...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12121 ==
+
== Metabolite CPD-15424 ==
 
* common-name:
 
* common-name:
** demethylmenaquinol-12
+
** o-carbamoyladenylate
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o
 
* inchi-key:
 
* inchi-key:
** nkcmhmxwladgov-rvhibigxsa-n
+
** chsnpofvfypelh-kqynxxcusa-m
 
* molecular-weight:
 
* molecular-weight:
** 977.59
+
** 389.241
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9363]]
+
* [[RXN-13167]]
 +
* [[RXN-13168]]
 +
* [[RXN-14553]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14552]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=demethylmenaquinol-12}}
+
{{#set: common-name=o-carbamoyladenylate}}
{{#set: inchi-key=inchikey=nkcmhmxwladgov-rvhibigxsa-n}}
+
{{#set: inchi-key=inchikey=chsnpofvfypelh-kqynxxcusa-m}}
{{#set: molecular-weight=977.59}}
+
{{#set: molecular-weight=389.241}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-15424

  • common-name:
    • o-carbamoyladenylate
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o
  • inchi-key:
    • chsnpofvfypelh-kqynxxcusa-m
  • molecular-weight:
    • 389.241

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality