Difference between revisions of "CPD-15424"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Nucleoside-Triphosphates == * common-name: ** a nucleoside triphosphate == Reaction(s) known to consume the compound == * [[2.7.4.10-RXN]...") |
(Created page with "Category:metabolite == Metabolite CPD-15424 == * common-name: ** o-carbamoyladenylate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o * inch...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15424 == |
* common-name: | * common-name: | ||
| − | ** | + | ** o-carbamoyladenylate |
| + | * smiles: | ||
| + | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o | ||
| + | * inchi-key: | ||
| + | ** chsnpofvfypelh-kqynxxcusa-m | ||
| + | * molecular-weight: | ||
| + | ** 389.241 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-13167]] |
| − | + | * [[RXN-13168]] | |
| − | + | * [[RXN-14553]] | |
| − | * [[ | ||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14552]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=o-carbamoyladenylate}} |
| + | {{#set: inchi-key=inchikey=chsnpofvfypelh-kqynxxcusa-m}} | ||
| + | {{#set: molecular-weight=389.241}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-15424
- common-name:
- o-carbamoyladenylate
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o
- inchi-key:
- chsnpofvfypelh-kqynxxcusa-m
- molecular-weight:
- 389.241
