Difference between revisions of "CPD-15424"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-305 RXN66-305] == * direction: ** left-to-right * common-name: ** 14-oxolanosterol deformylas...")
 
(Created page with "Category:metabolite == Metabolite CPD-15424 == * common-name: ** o-carbamoyladenylate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o * inch...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-305 RXN66-305] ==
+
== Metabolite CPD-15424 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 14-oxolanosterol deformylase
+
** o-carbamoyladenylate
−
** 4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol,nadph:oxygen oxidoreductase (14-methyl cleaving)
+
* smiles:
−
== Reaction formula ==
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o
−
* 1 [[CPD-4573]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[44-DIMETHYL-CHOLESTA-814-24-TRIENOL]][c] '''+''' 1 [[FORMATE]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[WATER]][c]
+
* inchi-key:
−
== Gene(s) associated with this reaction  ==
+
** chsnpofvfypelh-kqynxxcusa-m
−
* Gene: [[SJ05072]]
+
* molecular-weight:
−
** Category: [[annotation]]
+
** 389.241
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to consume the compound ==
−
** Category: [[orthology]]
+
* [[RXN-13167]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-13168]]
−
== Pathway(s) ==
+
* [[RXN-14553]]
−
* [[PWY66-341]], cholesterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-341 PWY66-341]
+
== Reaction(s) known to produce the compound ==
−
** '''14''' reactions found over '''18''' reactions in the full pathway
+
* [[RXN-14552]]
−
* [[PWY66-4]], cholesterol biosynthesis III (via desmosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4]
+
== Reaction(s) of unknown directionality ==
−
** '''14''' reactions found over '''4''' reactions in the full pathway
+
{{#set: common-name=o-carbamoyladenylate}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=chsnpofvfypelh-kqynxxcusa-m}}
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=389.241}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol,nadph:oxygen oxidoreductase (14-methyl cleaving)|14-oxolanosterol deformylase}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-15424

  • common-name:
    • o-carbamoyladenylate
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o
  • inchi-key:
    • chsnpofvfypelh-kqynxxcusa-m
  • molecular-weight:
    • 389.241

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-15424&oldid=139176"