Difference between revisions of "CPD-15424"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=biomass_rxn biomass_rxn] == * direction: ** left-to-right == Reaction formula == * 0.01 4-AMINO-B...")
(Created page with "Category:metabolite == Metabolite CPD-7221 == * common-name: ** (3z)-dodec-3-enoyl-coa * smiles: ** ccccccccc=ccc(sccnc(ccnc(c(c(cop(op(occ3(c(op(=o)([o-])[o-])c(o)c(n2(c1...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=biomass_rxn biomass_rxn] ==
+
== Metabolite CPD-7221 ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** (3z)-dodec-3-enoyl-coa
−
== Reaction formula ==
+
* smiles:
−
* 0.01 [[4-AMINO-BUTYRATE]][c] '''+''' 0.1 [[ARG]][c] '''+''' 0.75 [[ASN]][c] '''+''' 19.3055 [[CIT]][c] '''+''' 0.3 [[CYS]][c] '''+''' 2.7615 [[GLC]][c] '''+''' 10.7 [[GLN]][c] '''+''' 18.85 [[GLT]][c] '''+''' 3.8 [[GLY]][c] '''+''' 0.123 [[GLYCERATE]][c] '''+''' 2.375 [[GLYCEROL]][c] '''+''' 0.029 [[GLYCOLLATE]][c] '''+''' 0.1 [[HIS]][c] '''+''' 0.2 [[ILE]][c] '''+''' 26.6 [[L-ALPHA-ALANINE]][c] '''+''' 12.5 [[L-ASPARTATE]][c] '''+''' 0.1 [[L-ORNITHINE]][c] '''+''' 0.3 [[LEU]][c] '''+''' 0.35 [[LYS]][c] '''+''' 331.4 [[MANNITOL]][c] '''+''' 0.3 [[MET]][c] '''+''' 0.35 [[PHE]][c] '''+''' 1.35 [[PRO]][c] '''+''' 3.35 [[SER]][c] '''+''' 0.878 [[SUC]][c] '''+''' 0.65 [[THR]][c] '''+''' 9.37 [[THREO-DS-ISO-CITRATE]][c] '''+''' 0.115 [[TRP]][c] '''+''' 0.125 [[TYR]][c] '''+''' 0.85 [[VAL]][c] '''=>''' 1 [[BIOMASS]][c]
+
** ccccccccc=ccc(sccnc(ccnc(c(c(cop(op(occ3(c(op(=o)([o-])[o-])c(o)c(n2(c1(n=cn=c(n)c=1n=c2)))o3))(=o)[o-])(=o)[o-])(c)c)o)=o)=o)=o
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
== Pathway(s) ==
+
** xemivmktvgrftd-qxmhvhedsa-j
−
== Reconstruction information  ==
+
* molecular-weight:
−
* category: [[manual]]; source: [[biomass_reaction]]; tool: [[curation]]; comment: forfba
+
** 943.792
−
== External links  ==
+
== Reaction(s) known to consume the compound ==
−
{{#set: direction=left-to-right}}
+
* [[RXN-7931]]
−
{{#set: nb gene associated=0}}
+
== Reaction(s) known to produce the compound ==
−
{{#set: nb pathway associated=0}}
+
* [[RXN-14394]]
−
{{#set: reconstruction category=manual}}
+
* [[RXN-7931]]
−
{{#set: reconstruction tool=curation}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: reconstruction comment=forfba}}
+
{{#set: common-name=(3z)-dodec-3-enoyl-coa}}
−
{{#set: reconstruction source=biomass_reaction}}
+
{{#set: inchi-key=inchikey=xemivmktvgrftd-qxmhvhedsa-j}}
 +
{{#set: molecular-weight=943.792}}

Revision as of 20:36, 18 December 2020

Metabolite CPD-7221

  • common-name:
    • (3z)-dodec-3-enoyl-coa
  • smiles:
    • ccccccccc=ccc(sccnc(ccnc(c(c(cop(op(occ3(c(op(=o)([o-])[o-])c(o)c(n2(c1(n=cn=c(n)c=1n=c2)))o3))(=o)[o-])(=o)[o-])(c)c)o)=o)=o)=o
  • inchi-key:
    • xemivmktvgrftd-qxmhvhedsa-j
  • molecular-weight:
    • 943.792

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-15424&oldid=47992"