Difference between revisions of "CPD-15425"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Protein-ribulosamines == * common-name: ** a [protein]-n6-d-ribulosyl-l-lysine == Reaction(s) known to consume the compound == * RXN-12...") |
(Created page with "Category:metabolite == Metabolite CPD-15425 == * common-name: ** 6''-o-carbamoylkanamycin a * smiles: ** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15425 == |
* common-name: | * common-name: | ||
| − | ** a [ | + | ** 6''-o-carbamoylkanamycin a |
| + | * smiles: | ||
| + | ** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+])) | ||
| + | * inchi-key: | ||
| + | ** prwqrpnqdikfbr-noamyhissa-r | ||
| + | * molecular-weight: | ||
| + | ** 531.559 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-13167]] |
| + | * [[RXN-15285]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=a | + | {{#set: common-name=6''-o-carbamoylkanamycin a}} |
| + | {{#set: inchi-key=inchikey=prwqrpnqdikfbr-noamyhissa-r}} | ||
| + | {{#set: molecular-weight=531.559}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-15425
- common-name:
- 6-o-carbamoylkanamycin a
- smiles:
- c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
- inchi-key:
- prwqrpnqdikfbr-noamyhissa-r
- molecular-weight:
- 531.559
