Difference between revisions of "CPD-15425"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7186 RXN-7186] == * direction: ** reversible * common-name: ** myo-inositol-1,2,3,4,6-heptakisp...") |
(Created page with "Category:metabolite == Metabolite CPD-15425 == * common-name: ** 6''-o-carbamoylkanamycin a * smiles: ** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-15425 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** 6''-o-carbamoylkanamycin a |
| − | * | + | * smiles: |
| − | ** [ | + | ** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+])) |
| − | + | * inchi-key: | |
| − | + | ** prwqrpnqdikfbr-noamyhissa-r | |
| − | + | * molecular-weight: | |
| − | + | ** 531.559 | |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | *** | + | == Reaction(s) known to produce the compound == |
| − | == | + | * [[RXN-13167]] |
| − | == | + | * [[RXN-15285]] |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | == | + | {{#set: common-name=6''-o-carbamoylkanamycin a}} |
| − | + | {{#set: inchi-key=inchikey=prwqrpnqdikfbr-noamyhissa-r}} | |
| − | {{#set: common-name= | + | {{#set: molecular-weight=531.559}} |
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-15425
- common-name:
- 6-o-carbamoylkanamycin a
- smiles:
- c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
- inchi-key:
- prwqrpnqdikfbr-noamyhissa-r
- molecular-weight:
- 531.559
