Difference between revisions of "CPD-15425"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10353 == * common-name: ** (r)-acetoin * smiles: ** cc(o)c(=o)c * inchi-key: ** rowkjavdogwpat-gsvougtgsa-n * molecular-weight: ** 88...") |
(Created page with "Category:metabolite == Metabolite CPD-15425 == * common-name: ** 6''-o-carbamoylkanamycin a * smiles: ** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-15425 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 6''-o-carbamoylkanamycin a |
* smiles: | * smiles: | ||
| − | ** cc(o)c( | + | ** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+])) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** prwqrpnqdikfbr-noamyhissa-r |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 531.559 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-13167]] |
| + | * [[RXN-15285]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=6''-o-carbamoylkanamycin a}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=prwqrpnqdikfbr-noamyhissa-r}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=531.559}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-15425
- common-name:
- 6-o-carbamoylkanamycin a
- smiles:
- c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
- inchi-key:
- prwqrpnqdikfbr-noamyhissa-r
- molecular-weight:
- 531.559
