Difference between revisions of "CPD-15431"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ01032 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * ADENYL-KIN-RXN ** Cate...") |
(Created page with "Category:metabolite == Metabolite CPD-15431 == * common-name: ** n-acetyl-α-d-galactosaminyl-(1→3)-n-acetyl-α-d-galactosaminyldiphospho-ditrans,octacis-un...") |
||
| (9 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-15431 == |
| − | + | * common-name: | |
| − | * | + | ** n-acetyl-α-d-galactosaminyl-(1→3)-n-acetyl-α-d-galactosaminyldiphospho-ditrans,octacis-undecaprenol |
| − | + | * smiles: | |
| − | + | ** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(=o)([o-])op([o-])(=o)oc1(c(c(c(c(o1)co)o)oc2(oc(co)c(o)c(o)c(nc(=o)c)2))nc(c)=o))c)c)c)c)c)c)c | |
| − | + | * inchi-key: | |
| − | ** | + | ** sgclprbyahbrpd-qozjjacasa-l |
| − | + | * molecular-weight: | |
| − | * | + | ** 1331.648 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-14561]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | ** | + | == Reaction(s) of unknown directionality == |
| − | * | + | {{#set: common-name=n-acetyl-α-d-galactosaminyl-(1→3)-n-acetyl-α-d-galactosaminyldiphospho-ditrans,octacis-undecaprenol}} |
| − | + | {{#set: inchi-key=inchikey=sgclprbyahbrpd-qozjjacasa-l}} | |
| − | ** | + | {{#set: molecular-weight=1331.648}} |
| − | == | ||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-15431
- common-name:
- n-acetyl-α-d-galactosaminyl-(1→3)-n-acetyl-α-d-galactosaminyldiphospho-ditrans,octacis-undecaprenol
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(=o)([o-])op([o-])(=o)oc1(c(c(c(c(o1)co)o)oc2(oc(co)c(o)c(o)c(nc(=o)c)2))nc(c)=o))c)c)c)c)c)c)c
- inchi-key:
- sgclprbyahbrpd-qozjjacasa-l
- molecular-weight:
- 1331.648
