Difference between revisions of "CPD-15432"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16620 RXN-16620] == * direction: ** left-to-right * common-name: ** (2e,5z)-tetradeca-2,5-dieno...") |
(Created page with "Category:metabolite == Metabolite CPD-15432 == * common-name: ** β-d-galactosyl-(1→3)-n-acetyl-α-d-galactosaminyl-(1→3)-n-acetyl-α-d-galactosami...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-15432 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** ( | + | ** β-d-galactosyl-(1→3)-n-acetyl-α-d-galactosaminyl-(1→3)-n-acetyl-α-d-galactosaminyldiphospho-ditrans,octacis-undecaprenol |
− | + | * smiles: | |
− | + | ** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(=o)([o-])op([o-])(=o)oc1(c(c(c(c(o1)co)o)oc3(oc(co)c(o)c(oc2(oc(co)c(o)c(o)c(o)2))c(nc(=o)c)3))nc(c)=o))c)c)c)c)c)c)c | |
− | + | * inchi-key: | |
− | + | ** dthgkyazbnwfmj-rijyeuhmsa-l | |
− | = | + | * molecular-weight: |
− | * | + | ** 1493.79 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-14561]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=β-d-galactosyl-(1→3)-n-acetyl-α-d-galactosaminyl-(1→3)-n-acetyl-α-d-galactosaminyldiphospho-ditrans,octacis-undecaprenol}} | |
− | + | {{#set: inchi-key=inchikey=dthgkyazbnwfmj-rijyeuhmsa-l}} | |
− | ** | + | {{#set: molecular-weight=1493.79}} |
− | == | ||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | == | ||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-15432
- common-name:
- β-d-galactosyl-(1→3)-n-acetyl-α-d-galactosaminyl-(1→3)-n-acetyl-α-d-galactosaminyldiphospho-ditrans,octacis-undecaprenol
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(=o)([o-])op([o-])(=o)oc1(c(c(c(c(o1)co)o)oc3(oc(co)c(o)c(oc2(oc(co)c(o)c(o)c(o)2))c(nc(=o)c)3))nc(c)=o))c)c)c)c)c)c)c
- inchi-key:
- dthgkyazbnwfmj-rijyeuhmsa-l
- molecular-weight:
- 1493.79