Difference between revisions of "CPD-15435"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7733 == * common-name: ** aurachin c * smiles: ** cc(c)=cccc(c)=cccc(c)=ccc2(c(c1(c=cc=cc=1n(c(c)=2)o))=o) * inchi-key: ** fihxchbehl...")
(Created page with "Category:metabolite == Metabolite IPC == * common-name: ** an inositol-phospho-α hydroxyphytoceramide == Reaction(s) known to consume the compound == == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7733 ==
+
== Metabolite IPC ==
 
* common-name:
 
* common-name:
** aurachin c
+
** an inositol-phospho-α hydroxyphytoceramide
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=ccc2(c(c1(c=cc=cc=1n(c(c)=2)o))=o)
 
* inchi-key:
 
** fihxchbehlcxeg-yefhwucqsa-n
 
* molecular-weight:
 
** 379.541
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15029]]
 
* [[RXN-17335]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN3O-581]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=aurachin c}}
+
{{#set: common-name=an inositol-phospho-α hydroxyphytoceramide}}
{{#set: inchi-key=inchikey=fihxchbehlcxeg-yefhwucqsa-n}}
 
{{#set: molecular-weight=379.541}}
 

Revision as of 18:59, 14 January 2021

Metabolite IPC

  • common-name:
    • an inositol-phospho-α hydroxyphytoceramide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality