Difference between revisions of "CPD-15435"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7733 == * common-name: ** aurachin c * smiles: ** cc(c)=cccc(c)=cccc(c)=ccc2(c(c1(c=cc=cc=1n(c(c)=2)o))=o) * inchi-key: ** fihxchbehl...") |
(Created page with "Category:metabolite == Metabolite IPC == * common-name: ** an inositol-phospho-α hydroxyphytoceramide == Reaction(s) known to consume the compound == == Reaction(s)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite IPC == |
* common-name: | * common-name: | ||
− | ** | + | ** an inositol-phospho-α hydroxyphytoceramide |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN3O-581]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an inositol-phospho-α hydroxyphytoceramide}} |
− | |||
− |
Revision as of 18:59, 14 January 2021
Contents
Metabolite IPC
- common-name:
- an inositol-phospho-α hydroxyphytoceramide