Difference between revisions of "CPD-15435"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DSERDEAM-RXN DSERDEAM-RXN] == * direction: ** left-to-right * common-name: ** d-serine ammonia-lyas...") |
(Created page with "Category:metabolite == Metabolite CPD-15435 == * common-name: ** l-threonylcarbamoyladenylate * smiles: ** cc(o)c(c([o-])=o)nc(=o)op(occ3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-15435 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** l-threonylcarbamoyladenylate |
| − | * | + | * smiles: |
| − | ** [ | + | ** cc(o)c(c([o-])=o)nc(=o)op(occ3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))([o-])=o |
| − | == | + | * inchi-key: |
| − | + | ** ghlupquheijrcu-dwvddhqfsa-l | |
| − | == | + | * molecular-weight: |
| − | * | + | ** 490.322 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | ** | + | * [[RXN-14569]] |
| − | == | + | * [[RXN-14570]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-14569]] |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | * | + | {{#set: common-name=l-threonylcarbamoyladenylate}} |
| − | + | {{#set: inchi-key=inchikey=ghlupquheijrcu-dwvddhqfsa-l}} | |
| − | + | {{#set: molecular-weight=490.322}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: common-name= | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CPD-15435
- common-name:
- l-threonylcarbamoyladenylate
- smiles:
- cc(o)c(c([o-])=o)nc(=o)op(occ3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))([o-])=o
- inchi-key:
- ghlupquheijrcu-dwvddhqfsa-l
- molecular-weight:
- 490.322
