Difference between revisions of "CPD-15435"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CO+2 == * common-name: ** co2+ * smiles: ** [co++] * inchi-key: ** xljkhnwparrrjb-uhfffaoysa-n * molecular-weight: ** 58.93 == Reaction(s...")
(Created page with "Category:metabolite == Metabolite CPD-15435 == * common-name: ** l-threonylcarbamoyladenylate * smiles: ** cc(o)c(c([o-])=o)nc(=o)op(occ3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CO+2 ==
+
== Metabolite CPD-15435 ==
 
* common-name:
 
* common-name:
** co2+
+
** l-threonylcarbamoyladenylate
 
* smiles:
 
* smiles:
** [co++]
+
** cc(o)c(c([o-])=o)nc(=o)op(occ3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))([o-])=o
 
* inchi-key:
 
* inchi-key:
** xljkhnwparrrjb-uhfffaoysa-n
+
** ghlupquheijrcu-dwvddhqfsa-l
 
* molecular-weight:
 
* molecular-weight:
** 58.93
+
** 490.322
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4.99.1.3-RXN]]
+
* [[RXN-14569]]
* [[ExchangeSeed-CO+2]]
+
* [[RXN-14570]]
* [[RXN-8759]]
 
* [[TransportSeed-CO+2]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ExchangeSeed-CO+2]]
+
* [[RXN-14569]]
* [[TransportSeed-CO+2]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=co2+}}
+
{{#set: common-name=l-threonylcarbamoyladenylate}}
{{#set: inchi-key=inchikey=xljkhnwparrrjb-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=ghlupquheijrcu-dwvddhqfsa-l}}
{{#set: molecular-weight=58.93}}
+
{{#set: molecular-weight=490.322}}

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-15435

  • common-name:
    • l-threonylcarbamoyladenylate
  • smiles:
    • cc(o)c(c([o-])=o)nc(=o)op(occ3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))([o-])=o
  • inchi-key:
    • ghlupquheijrcu-dwvddhqfsa-l
  • molecular-weight:
    • 490.322

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality