Difference between revisions of "CPD-15435"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7733 == * common-name: ** aurachin c * smiles: ** cc(c)=cccc(c)=cccc(c)=ccc2(c(c1(c=cc=cc=1n(c(c)=2)o))=o) * inchi-key: ** fihxchbehl...") |
(Created page with "Category:metabolite == Metabolite CPD-15435 == * common-name: ** l-threonylcarbamoyladenylate * smiles: ** cc(o)c(c([o-])=o)nc(=o)op(occ3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-15435 == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-threonylcarbamoyladenylate |
* smiles: | * smiles: | ||
| − | ** cc(c)= | + | ** cc(o)c(c([o-])=o)nc(=o)op(occ3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ghlupquheijrcu-dwvddhqfsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 490.322 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14569]] |
| − | * [[RXN- | + | * [[RXN-14570]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14569]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-threonylcarbamoyladenylate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ghlupquheijrcu-dwvddhqfsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=490.322}} |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CPD-15435
- common-name:
- l-threonylcarbamoyladenylate
- smiles:
- cc(o)c(c([o-])=o)nc(=o)op(occ3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))([o-])=o
- inchi-key:
- ghlupquheijrcu-dwvddhqfsa-l
- molecular-weight:
- 490.322
