|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.6-RXN 3.2.1.6-RXN] == | + | == Metabolite CPD-15435 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** glucan endo-1,3-beta-glucanase activity, c-3 substituted reducing group | + | ** l-threonylcarbamoyladenylate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/3.2.1.6 ec-3.2.1.6] | + | ** cc(o)c(c([o-])=o)nc(=o)op(occ3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))([o-])=o |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[Beta-D-glucan-w-C-3-substitution]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Beta-D-Glucans]][c]
| + | ** ghlupquheijrcu-dwvddhqfsa-l |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | ** 490.322 |
| − | * Gene: [[SJ11958]]
| + | == Reaction(s) known to consume the compound == |
| − | ** Category: [[annotation]]
| + | * [[RXN-14569]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[RXN-14570]] |
| − | ** Category: [[orthology]]
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[RXN-14569]] |
| − | * Gene: [[SJ10147]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[annotation]]
| + | {{#set: common-name=l-threonylcarbamoyladenylate}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | {{#set: inchi-key=inchikey=ghlupquheijrcu-dwvddhqfsa-l}} |
| − | * Gene: [[SJ02111]]
| + | {{#set: molecular-weight=490.322}} |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ06638]] | |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ14972]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ14973]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ02113]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | * Gene: [[SJ02112]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/Q9SSU7 Q9SSU7]
| |
| − | ** [http://www.uniprot.org/uniprot/P29716 P29716]
| |
| − | ** [http://www.uniprot.org/uniprot/Q59328 Q59328]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=glucan endo-1,3-beta-glucanase activity, c-3 substituted reducing group}} | |
| − | {{#set: ec-number=ec-3.2.1.6}} | |
| − | {{#set: nb gene associated=8}} | |
| − | {{#set: nb pathway associated=0}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools|pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
