Difference between revisions of "CPD-15436"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14407 == * common-name: ** dihomo γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(...") |
(Created page with "Category:metabolite == Metabolite ALPROSTADIL == * common-name: ** (13e)-(15s)-11-α,15-dihydroxy-9-oxoprost-13-enoate * smiles: ** cccccc(o)c=cc1(c(o)cc(=o)c(ccccccc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ALPROSTADIL == |
* common-name: | * common-name: | ||
| − | ** | + | ** (13e)-(15s)-11-α,15-dihydroxy-9-oxoprost-13-enoate |
* smiles: | * smiles: | ||
| − | ** cccccc | + | ** cccccc(o)c=cc1(c(o)cc(=o)c(ccccccc(=o)[o-])1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gmvprgqoioiimi-dwkjamrdsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 353.478 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[1.1.1.197-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1.1.1.197-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(13e)-(15s)-11-α,15-dihydroxy-9-oxoprost-13-enoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gmvprgqoioiimi-dwkjamrdsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=353.478}} |
Revision as of 08:26, 15 March 2021
Contents
Metabolite ALPROSTADIL
- common-name:
- (13e)-(15s)-11-α,15-dihydroxy-9-oxoprost-13-enoate
- smiles:
- cccccc(o)c=cc1(c(o)cc(=o)c(ccccccc(=o)[o-])1)
- inchi-key:
- gmvprgqoioiimi-dwkjamrdsa-m
- molecular-weight:
- 353.478
