Difference between revisions of "CPD-15436"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02790 == * transcription-direction: ** negative * right-end-position: ** 451087 * left-end-position: ** 435097 * centisome-position: ** 40.110237...") |
(Created page with "Category:metabolite == Metabolite CPD-15436 == * common-name: ** (5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-15436 == |
− | * | + | * common-name: |
− | ** | + | ** (5z)-tetradecenoyl-coa |
− | + | * smiles: | |
− | + | ** ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o | |
− | * | + | * inchi-key: |
− | ** | + | ** mrvdzohjmltlhj-stfckwfxsa-j |
− | + | * molecular-weight: | |
− | + | ** 971.845 | |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-14576]] | |
− | = | + | * [[RXN-17783]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-17782]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=(5z)-tetradecenoyl-coa}} | |
− | + | {{#set: inchi-key=inchikey=mrvdzohjmltlhj-stfckwfxsa-j}} | |
− | + | {{#set: molecular-weight=971.845}} | |
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-15436
- common-name:
- (5z)-tetradecenoyl-coa
- smiles:
- ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
- inchi-key:
- mrvdzohjmltlhj-stfckwfxsa-j
- molecular-weight:
- 971.845