Difference between revisions of "CPD-15436"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21121 == * transcription-direction: ** positive * right-end-position: ** 534078 * left-end-position: ** 525703 * centisome-position: ** 86.97917...")
 
(Created page with "Category:metabolite == Metabolite CPD-15436 == * common-name: ** (5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ21121 ==
+
== Metabolite CPD-15436 ==
* transcription-direction:
+
* common-name:
** positive
+
** (5z)-tetradecenoyl-coa
* right-end-position:
+
* smiles:
** 534078
+
** ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
* left-end-position:
+
* inchi-key:
** 525703
+
** mrvdzohjmltlhj-stfckwfxsa-j
* centisome-position:
+
* molecular-weight:
** 86.97917   
+
** 971.845
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-14576]]
== Reaction(s) associated ==
+
* [[RXN-17783]]
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to produce the compound ==
* [[ADPREDUCT-RXN]]
+
* [[RXN-17782]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=(5z)-tetradecenoyl-coa}}
* [[CDPREDUCT-RXN]]
+
{{#set: inchi-key=inchikey=mrvdzohjmltlhj-stfckwfxsa-j}}
** Category: [[annotation]]
+
{{#set: molecular-weight=971.845}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[GDPREDUCT-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RIBONUCLEOSIDE-DIP-REDUCTI-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN0-722]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN0-747]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN0-748]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[UDPREDUCT-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
</div>
 
== Pathway(s) associated ==
 
* [[PWY-7220]]
 
** '''4''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY-7227]]
 
** '''2''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY0-166]]
 
** '''14''' reactions found over '''13''' reactions in the full pathway
 
* [[PWY-7210]]
 
** '''8''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY-7198]]
 
** '''6''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-7184]]
 
** '''9''' reactions found over '''9''' reactions in the full pathway
 
* [[PWY-6545]]
 
** '''8''' reactions found over '''9''' reactions in the full pathway
 
* [[PWY-7222]]
 
** '''4''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY-7226]]
 
** '''2''' reactions found over '''2''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=534078}}
 
{{#set: left-end-position=525703}}
 
{{#set: centisome-position=86.97917    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=9}}
 
{{#set: nb pathway associated=9}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-15436

  • common-name:
    • (5z)-tetradecenoyl-coa
  • smiles:
    • ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • mrvdzohjmltlhj-stfckwfxsa-j
  • molecular-weight:
    • 971.845

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality