Difference between revisions of "CPD-15436"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1-Stearoyl-L-Phosphatidate == * common-name: ** a 1-stearoyl 2-acyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the compound...") |
(Created page with "Category:metabolite == Metabolite N-ACETYL-5-METHOXY-TRYPTAMINE == * common-name: ** melatonin * smiles: ** cc(=o)nccc2(=cnc1(=c(c=c(oc)c=c1)2)) * inchi-key: ** drlfmbdrbr...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-ACETYL-5-METHOXY-TRYPTAMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** melatonin |
| + | * smiles: | ||
| + | ** cc(=o)nccc2(=cnc1(=c(c=c(oc)c=c1)2)) | ||
| + | * inchi-key: | ||
| + | ** drlfmbdrbrzale-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 232.282 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-11056]] | ||
| + | * [[RXN-11057]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=melatonin}} |
| + | {{#set: inchi-key=inchikey=drlfmbdrbrzale-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=232.282}} | ||
Revision as of 14:55, 5 January 2021
Contents
Metabolite N-ACETYL-5-METHOXY-TRYPTAMINE
- common-name:
- melatonin
- smiles:
- cc(=o)nccc2(=cnc1(=c(c=c(oc)c=c1)2))
- inchi-key:
- drlfmbdrbrzale-uhfffaoysa-n
- molecular-weight:
- 232.282
