Difference between revisions of "CPD-15436"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYL-5-METHOXY-TRYPTAMINE == * common-name: ** melatonin * smiles: ** cc(=o)nccc2(=cnc1(=c(c=c(oc)c=c1)2)) * inchi-key: ** drlfmbdrbr...") |
(Created page with "Category:metabolite == Metabolite CPD-1137 == * common-name: ** itaconyl-coa * smiles: ** c=c(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-1137 == |
* common-name: | * common-name: | ||
| − | ** | + | ** itaconyl-coa |
* smiles: | * smiles: | ||
| − | ** cc(=o) | + | ** c=c(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nfvgylgssjprkw-citakdkdsa-i |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 874.579 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-8988]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=itaconyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nfvgylgssjprkw-citakdkdsa-i}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=874.579}} |
Revision as of 15:26, 5 January 2021
Contents
Metabolite CPD-1137
- common-name:
- itaconyl-coa
- smiles:
- c=c(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o
- inchi-key:
- nfvgylgssjprkw-citakdkdsa-i
- molecular-weight:
- 874.579
