Difference between revisions of "CPD-15530"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-HYDROXYPHYTANOYL-COA == * common-name: ** 2-hydroxyphytanoyl-coa * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)c(o)c(=o)sccnc(=o)ccnc(=o)c(o)c...")
(Created page with "Category:metabolite == Metabolite Protein-phospho-ribulosamines == * common-name: ** a [protein]-n6-(3-o-phospho-d-ribulosyl)-l-lysine == Reaction(s) known to consume the...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-HYDROXYPHYTANOYL-COA ==
+
== Metabolite Protein-phospho-ribulosamines ==
 
* common-name:
 
* common-name:
** 2-hydroxyphytanoyl-coa
+
** a [protein]-n6-(3-o-phospho-d-ribulosyl)-l-lysine
* smiles:
 
** cc(c)cccc(c)cccc(c)cccc(c)c(o)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** wnvfjmypvbolkv-ylnukallsa-j
 
* molecular-weight:
 
** 1074.021
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12003]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.14.11.18-RXN]]
+
* [[RXN-12003]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-hydroxyphytanoyl-coa}}
+
{{#set: common-name=a [protein]-n6-(3-o-phospho-d-ribulosyl)-l-lysine}}
{{#set: inchi-key=inchikey=wnvfjmypvbolkv-ylnukallsa-j}}
 
{{#set: molecular-weight=1074.021}}
 

Revision as of 08:29, 15 March 2021

Metabolite Protein-phospho-ribulosamines

  • common-name:
    • a [protein]-n6-(3-o-phospho-d-ribulosyl)-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-n6-(3-o-phospho-d-ribulosyl)-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.