Difference between revisions of "CPD-15566"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9861 == * common-name: ** 3-demethylubiquinol-7 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(...")
(Created page with "Category:metabolite == Metabolite CPD0-1162 == * common-name: ** (2e,5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9861 ==
+
== Metabolite CPD0-1162 ==
 
* common-name:
 
* common-name:
** 3-demethylubiquinol-7
+
** (2e,5z)-tetradecenoyl-coa
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
+
** ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
* inchi-key:
** ohbhbmxnjcumcr-dkccahehsa-n
+
** jvefyxpcqbmmaa-zmlwrgbosa-j
 
* molecular-weight:
 
* molecular-weight:
** 646.992
+
** 969.83
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9229]]
+
* [[RXN0-5393]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14576]]
 +
* [[RXN-17783]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-demethylubiquinol-7}}
+
{{#set: common-name=(2e,5z)-tetradecenoyl-coa}}
{{#set: inchi-key=inchikey=ohbhbmxnjcumcr-dkccahehsa-n}}
+
{{#set: inchi-key=inchikey=jvefyxpcqbmmaa-zmlwrgbosa-j}}
{{#set: molecular-weight=646.992}}
+
{{#set: molecular-weight=969.83}}

Revision as of 11:14, 15 January 2021

Metabolite CPD0-1162

  • common-name:
    • (2e,5z)-tetradecenoyl-coa
  • smiles:
    • ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • jvefyxpcqbmmaa-zmlwrgbosa-j
  • molecular-weight:
    • 969.83

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality