Difference between revisions of "CPD-15566"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18295 == * transcription-direction: ** negative * right-end-position: ** 270885 * left-end-position: ** 266187 * centisome-position: ** 41.05898...") |
(Created page with "Category:metabolite == Metabolite CPD-15566 == * common-name: ** (2e,4e)-tetradecadienoyl-coa * smiles: ** cccccccccc=cc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-15566 == |
− | * | + | * common-name: |
− | ** | + | ** (2e,4e)-tetradecadienoyl-coa |
− | + | * smiles: | |
− | * | + | ** cccccccccc=cc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o |
− | + | * inchi-key: | |
− | ** | + | ** ulogshzmdlrqry-inbgbncrsa-j |
− | + | * molecular-weight: | |
− | + | ** 969.83 | |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-14715]] | |
− | = | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | {{#set: common-name=(2e,4e)-tetradecadienoyl-coa}} |
− | ** | + | {{#set: inchi-key=inchikey=ulogshzmdlrqry-inbgbncrsa-j}} |
− | + | {{#set: molecular-weight=969.83}} | |
− | * | ||
− | ** | ||
− | * | ||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-15566
- common-name:
- (2e,4e)-tetradecadienoyl-coa
- smiles:
- cccccccccc=cc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
- inchi-key:
- ulogshzmdlrqry-inbgbncrsa-j
- molecular-weight:
- 969.83