Difference between revisions of "CPD-15566"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14706 == * common-name: ** 4-hydroxy-2-nonenal-[l-cys] conjugate * smiles: ** cccccc(o)c(cc=o)scc([n+])c(=o)[o-] * inchi-key: ** salp...")
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N2-Methylguanine-10 == * common-name: ** an n2-methylguanine10 in trna == Reaction(s) known to consume the compound == ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14706 ==
+
== Metabolite tRNA-Containing-N2-Methylguanine-10 ==
 
* common-name:
 
* common-name:
** 4-hydroxy-2-nonenal-[l-cys] conjugate
+
** an n2-methylguanine10 in trna
* smiles:
 
** cccccc(o)c(cc=o)scc([n+])c(=o)[o-]
 
* inchi-key:
 
** salpdushmtyyoh-uhfffaoysa-n
 
* molecular-weight:
 
** 277.378
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13677]]
+
* [[RXN-12374]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-hydroxy-2-nonenal-[l-cys] conjugate}}
+
{{#set: common-name=an n2-methylguanine10 in trna}}
{{#set: inchi-key=inchikey=salpdushmtyyoh-uhfffaoysa-n}}
 
{{#set: molecular-weight=277.378}}
 

Revision as of 13:09, 14 January 2021

Metabolite tRNA-Containing-N2-Methylguanine-10

  • common-name:
    • an n2-methylguanine10 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality