Difference between revisions of "CPD-15566"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N2-Methylguanine-10 == * common-name: ** an n2-methylguanine10 in trna == Reaction(s) known to consume the compound == ==...") |
(Created page with "Category:metabolite == Metabolite CPD-9861 == * common-name: ** 3-demethylubiquinol-7 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9861 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-demethylubiquinol-7 |
| + | * smiles: | ||
| + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1) | ||
| + | * inchi-key: | ||
| + | ** ohbhbmxnjcumcr-dkccahehsa-n | ||
| + | * molecular-weight: | ||
| + | ** 646.992 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-9229]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-demethylubiquinol-7}} |
| + | {{#set: inchi-key=inchikey=ohbhbmxnjcumcr-dkccahehsa-n}} | ||
| + | {{#set: molecular-weight=646.992}} | ||
Revision as of 18:54, 14 January 2021
Contents
Metabolite CPD-9861
- common-name:
- 3-demethylubiquinol-7
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
- inchi-key:
- ohbhbmxnjcumcr-dkccahehsa-n
- molecular-weight:
- 646.992
