Difference between revisions of "CPD-15568"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ22039 == * transcription-direction: ** negative * right-end-position: ** 61145 * left-end-position: ** 32824 * centisome-position: ** 18.061861...") |
(Created page with "Category:metabolite == Metabolite CPD-8268 == * common-name: ** dioleoyl phosphatidate * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)[o-])=o *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-8268 == |
| − | * | + | * common-name: |
| − | ** | + | ** dioleoyl phosphatidate |
| − | * | + | * smiles: |
| − | ** | + | ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)[o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** mhuwzntuiifhas-dssvuwshsa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 698.959 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-15068]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[RXN-15043]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=dioleoyl phosphatidate}} | |
| − | + | {{#set: inchi-key=inchikey=mhuwzntuiifhas-dssvuwshsa-l}} | |
| − | + | {{#set: molecular-weight=698.959}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:33, 18 December 2020
Contents
Metabolite CPD-8268
- common-name:
- dioleoyl phosphatidate
- smiles:
- ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)[o-])=o
- inchi-key:
- mhuwzntuiifhas-dssvuwshsa-l
- molecular-weight:
- 698.959
