Difference between revisions of "CPD-15616"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-182 == * common-name: ** 4-methylumbelliferone * smiles: ** cc1(=cc(oc2(c=c(o)c=cc1=2))=o) * inchi-key: ** hshnitrmyyllcv-uhfffaoysa-...") |
(Created page with "Category:metabolite == Metabolite DNA-N4-Methylcytosine == * common-name: ** an n4-methylcytosine in dna == Reaction(s) known to consume the compound == == Reaction(s) kno...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DNA-N4-Methylcytosine == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n4-methylcytosine in dna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.1.1.113-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n4-methylcytosine in dna}} |
| − | |||
| − | |||
Revision as of 11:17, 15 January 2021
Contents
Metabolite DNA-N4-Methylcytosine
- common-name:
- an n4-methylcytosine in dna
