Difference between revisions of "CPD-15637"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ05430 == * transcription-direction: ** negative * right-end-position: ** 206965 * left-end-position: ** 199439 * centisome-position: ** 40.20356...")
(Created page with "Category:metabolite == Metabolite CPD-15637 == * common-name: ** 6-cis-tridecenoyl-coa * smiles: ** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...")
 
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ05430 ==
+
== Metabolite CPD-15637 ==
* transcription-direction:
+
* common-name:
** negative
+
** 6-cis-tridecenoyl-coa
* right-end-position:
+
* smiles:
** 206965
+
** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 199439
+
** uuivzebypbpkll-dxazuofzsa-j
* centisome-position:
+
* molecular-weight:
** 40.20356   
+
** 957.819
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-14771]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=6-cis-tridecenoyl-coa}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=uuivzebypbpkll-dxazuofzsa-j}}
* [[ACID-PHOSPHATASE-RXN]]
+
{{#set: molecular-weight=957.819}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-5822]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-6348]]
 
** '''1''' reactions found over '''1''' reactions in the full pathway
 
* [[NADPHOS-DEPHOS-PWY]]
 
** '''3''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY-5083]]
 
** '''5''' reactions found over '''6''' reactions in the full pathway
 
* [[NAD-BIOSYNTHESIS-II]]
 
** '''4''' reactions found over '''3''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=206965}}
 
{{#set: left-end-position=199439}}
 
{{#set: centisome-position=40.20356    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=3}}
 
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:10, 18 March 2021

Metabolite CPD-15637

  • common-name:
    • 6-cis-tridecenoyl-coa
  • smiles:
    • ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • uuivzebypbpkll-dxazuofzsa-j
  • molecular-weight:
    • 957.819

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality