Difference between revisions of "CPD-15637"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07766 == == Organism(s) associated with this gene == * S.japonica_sterols_curated == Reaction(s) associated == * 3.4.21.53-RXN ** Category...") |
(Created page with "Category:metabolite == Metabolite CPD-15637 == * common-name: ** 6-cis-tridecenoyl-coa * smiles: ** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...") |
||
(6 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-15637 == |
− | == | + | * common-name: |
− | + | ** 6-cis-tridecenoyl-coa | |
− | = | + | * smiles: |
− | + | ** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | |
− | ** | + | * inchi-key: |
− | *** | + | ** uuivzebypbpkll-dxazuofzsa-j |
− | {{#set: | + | * molecular-weight: |
− | {{#set: | + | ** 957.819 |
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-14771]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=6-cis-tridecenoyl-coa}} | ||
+ | {{#set: inchi-key=inchikey=uuivzebypbpkll-dxazuofzsa-j}} | ||
+ | {{#set: molecular-weight=957.819}} |
Latest revision as of 11:10, 18 March 2021
Contents
Metabolite CPD-15637
- common-name:
- 6-cis-tridecenoyl-coa
- smiles:
- ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- uuivzebypbpkll-dxazuofzsa-j
- molecular-weight:
- 957.819