Difference between revisions of "CPD-15651"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-uridine13 == * common-name: ** a uridine13 in trna == Reaction(s) known to consume the compound == * RXN-11841 == Reaction(s) kn...") |
(Created page with "Category:metabolite == Metabolite CPD-15651 == * common-name: ** 6-trans-tridecenoyl-coa * smiles: ** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15651 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 6-trans-tridecenoyl-coa |
| + | * smiles: | ||
| + | ** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** uuivzebypbpkll-hmxwsvnbsa-j | ||
| + | * molecular-weight: | ||
| + | ** 957.819 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14785]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=6-trans-tridecenoyl-coa}} |
| + | {{#set: inchi-key=inchikey=uuivzebypbpkll-hmxwsvnbsa-j}} | ||
| + | {{#set: molecular-weight=957.819}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-15651
- common-name:
- 6-trans-tridecenoyl-coa
- smiles:
- ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- uuivzebypbpkll-hmxwsvnbsa-j
- molecular-weight:
- 957.819
