Difference between revisions of "CPD-15651"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ00669 == * transcription-direction: ** negative * right-end-position: ** 154563 * left-end-position: ** 148234 * centisome-position: ** 90.49915...")
(Created page with "Category:metabolite == Metabolite CPD-15651 == * common-name: ** 6-trans-tridecenoyl-coa * smiles: ** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(o...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ00669 ==
+
== Metabolite CPD-15651 ==
* transcription-direction:
+
* common-name:
** negative
+
** 6-trans-tridecenoyl-coa
* right-end-position:
+
* smiles:
** 154563
+
** ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 148234
+
** uuivzebypbpkll-hmxwsvnbsa-j
* centisome-position:
+
* molecular-weight:
** 90.49915   
+
** 957.819
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-14785]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
* [[ENTDB-RXN]]
+
{{#set: common-name=6-trans-tridecenoyl-coa}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=uuivzebypbpkll-hmxwsvnbsa-j}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=957.819}}
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[HOLO-ACP-SYNTH-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN-10994]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN-15889]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN-16759]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
</div>
 
== Pathway(s) associated ==
 
* [[ENTBACSYN-PWY]]
 
** '''3''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY-6012]]
 
** '''2''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY-6012-1]]
 
** '''1''' reactions found over '''1''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=154563}}
 
{{#set: left-end-position=148234}}
 
{{#set: centisome-position=90.49915    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=5}}
 
{{#set: nb pathway associated=3}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-15651

  • common-name:
    • 6-trans-tridecenoyl-coa
  • smiles:
    • ccccccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • uuivzebypbpkll-hmxwsvnbsa-j
  • molecular-weight:
    • 957.819

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality