Difference between revisions of "CPD-15652"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite All-trans-Retinyl-Esters == * common-name: ** an all-trans-retinyl ester == Reaction(s) known to consume the compound == * RETINOL-O-FA...")
(Created page with "Category:metabolite == Metabolite CPD-19160 == * common-name: ** 3-oxo-(11z)-octadecenoyl-coa * smiles: ** ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite All-trans-Retinyl-Esters ==
+
== Metabolite CPD-19160 ==
 
* common-name:
 
* common-name:
** an all-trans-retinyl ester
+
** 3-oxo-(11z)-octadecenoyl-coa
 +
* smiles:
 +
** ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** ourowzutgfhrje-saiinbspsa-j
 +
* molecular-weight:
 +
** 1041.936
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
+
* [[RXN-17787]]
* [[RXN-12575]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
+
* [[RXN-17786]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an all-trans-retinyl ester}}
+
{{#set: common-name=3-oxo-(11z)-octadecenoyl-coa}}
 +
{{#set: inchi-key=inchikey=ourowzutgfhrje-saiinbspsa-j}}
 +
{{#set: molecular-weight=1041.936}}

Revision as of 08:32, 15 March 2021

Metabolite CPD-19160

  • common-name:
    • 3-oxo-(11z)-octadecenoyl-coa
  • smiles:
    • ccccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • ourowzutgfhrje-saiinbspsa-j
  • molecular-weight:
    • 1041.936

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality