Difference between revisions of "CPD-15652"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite All-trans-Retinyl-Esters == * common-name: ** an all-trans-retinyl ester == Reaction(s) known to consume the compound == * RETINOL-O-FA...")
(Created page with "Category:metabolite == Metabolite CPD-15652 == * common-name: ** (3r)-hydroxy, 6-trans-tridecenoyl-coa * smiles: ** ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite All-trans-Retinyl-Esters ==
+
== Metabolite CPD-15652 ==
 
* common-name:
 
* common-name:
** an all-trans-retinyl ester
+
** (3r)-hydroxy, 6-trans-tridecenoyl-coa
 +
* smiles:
 +
** ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** adzjvtnixnsngu-ovqifrbasa-j
 +
* molecular-weight:
 +
** 973.818
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
 
* [[RXN-12575]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
+
* [[RXN-14786]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an all-trans-retinyl ester}}
+
{{#set: common-name=(3r)-hydroxy, 6-trans-tridecenoyl-coa}}
 +
{{#set: inchi-key=inchikey=adzjvtnixnsngu-ovqifrbasa-j}}
 +
{{#set: molecular-weight=973.818}}

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-15652

  • common-name:
    • (3r)-hydroxy, 6-trans-tridecenoyl-coa
  • smiles:
    • ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • adzjvtnixnsngu-ovqifrbasa-j
  • molecular-weight:
    • 973.818

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality